C18H22F6N2O3 — CID 21447146
N-(1-piperidin-2-ylethyl)-2,5-bis(2,2,2-trifluoroethoxy)benzamide (PubChem CID 21447146) has the molecular formula C18H22F6N2O3 and a molecular weight of 428.37 g/mol. Its IUPAC name is N-(1-piperidin-2-ylethyl)-2,5-bis(2,2,2-trifluoroethoxy)benzamide.
| Compound Name | N-(1-piperidin-2-ylethyl)-2,5-bis(2,2,2-trifluoroethoxy)benzamide |
|---|---|
| PubChem CID | 21447146 |
| Molecular Formula | C18H22F6N2O3 |
| Molecular Weight | 428.37 g/mol |
| Exact Mass | 428.15 |
| IUPAC Name | N-(1-piperidin-2-ylethyl)-2,5-bis(2,2,2-trifluoroethoxy)benzamide |
| SMILES | CC(NC(=O)c1cc(OCC(F)(F)F)ccc1OCC(F)(F)F)C1CCCCN1 |
| InChI | InChI=1S/C18H22F6N2O3/c1-11(14-4-2-3-7-25-14)26-16(27)13-8-12(28-9-17(19,20)21)5-6-15(13)29-10-18(22,23)24/h5-6,8,11,14,25H,2-4,7,9-10H2,1H3,(H,26,27) |
| InChIKey | KESFQWJDLJCVLW-UHFFFAOYSA-N |
| XLogP | 3.83 |
| TPSA | 59.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.37 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |