C24H30ClF3N2O3 — CID 23035302
2-(3-phenylpropoxy)-N-(piperidin-2-ylmethyl)-5-(2,2,2-trifluoroethoxy)benzamide;hydrochloride (PubChem CID 23035302) has the molecular formula C24H30ClF3N2O3 and a molecular weight of 486.96 g/mol. Its IUPAC name is 2-(3-phenylpropoxy)-N-(piperidin-2-ylmethyl)-5-(2,2,2-trifluoroethoxy)benzamide;hydrochloride.
| Compound Name | 2-(3-phenylpropoxy)-N-(piperidin-2-ylmethyl)-5-(2,2,2-trifluoroethoxy)benzamide;hydrochloride |
|---|---|
| PubChem CID | 23035302 |
| Molecular Formula | C24H30ClF3N2O3 |
| Molecular Weight | 486.96 g/mol |
| Exact Mass | 486.19 |
| IUPAC Name | 2-(3-phenylpropoxy)-N-(piperidin-2-ylmethyl)-5-(2,2,2-trifluoroethoxy)benzamide;hydrochloride |
| SMILES | Cl.O=C(NCC1CCCCN1)c1cc(OCC(F)(F)F)ccc1OCCCc1ccccc1 |
| InChI | InChI=1S/C24H29F3N2O3.ClH/c25-24(26,27)17-32-20-11-12-22(31-14-6-9-18-7-2-1-3-8-18)21(15-20)23(30)29-16-19-10-4-5-13-28-19;/h1-3,7-8,11-12,15,19,28H,4-6,9-10,13-14,16-17H2,(H,29,30);1H |
| InChIKey | HEELOMDQPFGHLD-UHFFFAOYSA-N |
| XLogP | 4.93 |
| TPSA | 59.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.96 |
| LogP ≤ 5 | 4.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|