C12H9ClF6O3 — CID 12050208
1-[2,5-bis(2,2,2-trifluoroethoxy)phenyl]-2-chloroethanone (PubChem CID 12050208) has the molecular formula C12H9ClF6O3 and a molecular weight of 350.64 g/mol. Its IUPAC name is 1-[2,5-bis(2,2,2-trifluoroethoxy)phenyl]-2-chloroethanone.
| Compound Name | 1-[2,5-bis(2,2,2-trifluoroethoxy)phenyl]-2-chloroethanone |
|---|---|
| PubChem CID | 12050208 |
| Molecular Formula | C12H9ClF6O3 |
| Molecular Weight | 350.64 g/mol |
| Exact Mass | 350.01 |
| IUPAC Name | 1-[2,5-bis(2,2,2-trifluoroethoxy)phenyl]-2-chloroethanone |
| SMILES | O=C(CCl)c1cc(OCC(F)(F)F)ccc1OCC(F)(F)F |
| InChI | InChI=1S/C12H9ClF6O3/c13-4-9(20)8-3-7(21-5-11(14,15)16)1-2-10(8)22-6-12(17,18)19/h1-3H,4-6H2 |
| InChIKey | SDFSBBGUCPWSLK-UHFFFAOYSA-N |
| XLogP | 3.99 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.64 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|