C15H13F9N2O4 — CID 3782425
N-[2-[(2,2,2-trifluoroacetyl)amino]ethyl]-2,5-bis(2,2,2-trifluoroethoxy)benzamide (PubChem CID 3782425) has the molecular formula C15H13F9N2O4 and a molecular weight of 456.26 g/mol. Its IUPAC name is N-[2-[(2,2,2-trifluoroacetyl)amino]ethyl]-2,5-bis(2,2,2-trifluoroethoxy)benzamide.
| Compound Name | N-[2-[(2,2,2-trifluoroacetyl)amino]ethyl]-2,5-bis(2,2,2-trifluoroethoxy)benzamide |
|---|---|
| PubChem CID | 3782425 |
| Molecular Formula | C15H13F9N2O4 |
| Molecular Weight | 456.26 g/mol |
| Exact Mass | 456.07 |
| IUPAC Name | N-[2-[(2,2,2-trifluoroacetyl)amino]ethyl]-2,5-bis(2,2,2-trifluoroethoxy)benzamide |
| SMILES | O=C(NCCNC(=O)C(F)(F)F)c1cc(OCC(F)(F)F)ccc1OCC(F)(F)F |
| InChI | InChI=1S/C15H13F9N2O4/c16-13(17,18)6-29-8-1-2-10(30-7-14(19,20)21)9(5-8)11(27)25-3-4-26-12(28)15(22,23)24/h1-2,5H,3-4,6-7H2,(H,25,27)(H,26,28) |
| InChIKey | AVWBVEDPZAMCGR-UHFFFAOYSA-N |
| XLogP | 2.98 |
| TPSA | 76.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.26 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|