C18H13Cl2F6NO4 — CID 3816337
N-[(2,6-dichlorophenyl)methoxy]-2,5-bis(2,2,2-trifluoroethoxy)benzamide (PubChem CID 3816337) has the molecular formula C18H13Cl2F6NO4 and a molecular weight of 492.20 g/mol. Its IUPAC name is N-[(2,6-dichlorophenyl)methoxy]-2,5-bis(2,2,2-trifluoroethoxy)benzamide.
| Compound Name | N-[(2,6-dichlorophenyl)methoxy]-2,5-bis(2,2,2-trifluoroethoxy)benzamide |
|---|---|
| PubChem CID | 3816337 |
| Molecular Formula | C18H13Cl2F6NO4 |
| Molecular Weight | 492.20 g/mol |
| Exact Mass | 491.01 |
| IUPAC Name | N-[(2,6-dichlorophenyl)methoxy]-2,5-bis(2,2,2-trifluoroethoxy)benzamide |
| SMILES | O=C(NOCc1c(Cl)cccc1Cl)c1cc(OCC(F)(F)F)ccc1OCC(F)(F)F |
| InChI | InChI=1S/C18H13Cl2F6NO4/c19-13-2-1-3-14(20)12(13)7-31-27-16(28)11-6-10(29-8-17(21,22)23)4-5-15(11)30-9-18(24,25)26/h1-6H,7-9H2,(H,27,28) |
| InChIKey | MVDSUFBZYFTSND-UHFFFAOYSA-N |
| XLogP | 5.74 |
| TPSA | 56.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.20 |
| LogP ≤ 5 | 5.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|