C9H6Cl2F3NO2 — CID 81340977
2,4-dichloro-N-(2,2,2-trifluoroethoxy)benzamide (PubChem CID 81340977) has the molecular formula C9H6Cl2F3NO2 and a molecular weight of 288.05 g/mol. Its IUPAC name is 2,4-dichloro-N-(2,2,2-trifluoroethoxy)benzamide.
| Compound Name | 2,4-dichloro-N-(2,2,2-trifluoroethoxy)benzamide |
|---|---|
| PubChem CID | 81340977 |
| Molecular Formula | C9H6Cl2F3NO2 |
| Molecular Weight | 288.05 g/mol |
| Exact Mass | 286.97 |
| IUPAC Name | 2,4-dichloro-N-(2,2,2-trifluoroethoxy)benzamide |
| SMILES | O=C(NOCC(F)(F)F)c1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C9H6Cl2F3NO2/c10-5-1-2-6(7(11)3-5)8(16)15-17-4-9(12,13)14/h1-3H,4H2,(H,15,16) |
| InChIKey | WNMHAABEUKRLKQ-UHFFFAOYSA-N |
| XLogP | 3.22 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.05 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|