C9H6ClF4NO2 — CID 81435190
3-chloro-4-fluoro-N-(2,2,2-trifluoroethoxy)benzamide (PubChem CID 81435190) has the molecular formula C9H6ClF4NO2 and a molecular weight of 271.60 g/mol. Its IUPAC name is 3-chloro-4-fluoro-N-(2,2,2-trifluoroethoxy)benzamide.
| Compound Name | 3-chloro-4-fluoro-N-(2,2,2-trifluoroethoxy)benzamide |
|---|---|
| PubChem CID | 81435190 |
| Molecular Formula | C9H6ClF4NO2 |
| Molecular Weight | 271.60 g/mol |
| Exact Mass | 271.00 |
| IUPAC Name | 3-chloro-4-fluoro-N-(2,2,2-trifluoroethoxy)benzamide |
| SMILES | O=C(NOCC(F)(F)F)c1ccc(F)c(Cl)c1 |
| InChI | InChI=1S/C9H6ClF4NO2/c10-6-3-5(1-2-7(6)11)8(16)15-17-4-9(12,13)14/h1-3H,4H2,(H,15,16) |
| InChIKey | HNHHPDXJZKQEHX-UHFFFAOYSA-N |
| XLogP | 2.70 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.60 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|