About 5-amino-2-bromo-N-(2,2,2-trifluoroethoxy)benzamide
5-amino-2-bromo-N-(2,2,2-trifluoroethoxy)benzamide (PubChem CID 82721457) has the molecular formula C9H8BrF3N2O2
and a molecular weight of 313.07 g/mol. Its IUPAC name is 5-amino-2-bromo-N-(2,2,2-trifluoroethoxy)benzamide.
Molecular Properties
| Compound Name | 5-amino-2-bromo-N-(2,2,2-trifluoroethoxy)benzamide |
| PubChem CID | 82721457 |
| Molecular Formula | C9H8BrF3N2O2 |
| Molecular Weight | 313.07 g/mol |
| Exact Mass | 311.97 |
| IUPAC Name | 5-amino-2-bromo-N-(2,2,2-trifluoroethoxy)benzamide |
| SMILES | Nc1ccc(Br)c(C(=O)NOCC(F)(F)F)c1 |
| InChI | InChI=1S/C9H8BrF3N2O2/c10-7-2-1-5(14)3-6(7)8(16)15-17-4-9(11,12)13/h1-3H,4,14H2,(H,15,16) |
| InChIKey | NIXKOZWOAFPUNY-UHFFFAOYSA-N |
| XLogP | 2.26 |
| TPSA | 64.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 313.07 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 5-amino-2-bromo-N-(2,2,2-trifluoroethoxy)benzamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-amino-2-bromo-N-(2,2,2-trifluoroethoxy)benzamide?
The IUPAC name of 5-amino-2-bromo-N-(2,2,2-trifluoroethoxy)benzamide (CID 82721457) is 5-amino-2-bromo-N-(2,2,2-trifluoroethoxy)benzamide.
What is the SMILES notation for 5-amino-2-bromo-N-(2,2,2-trifluoroethoxy)benzamide?
The canonical SMILES for 5-amino-2-bromo-N-(2,2,2-trifluoroethoxy)benzamide is Nc1ccc(Br)c(C(=O)NOCC(F)(F)F)c1.
What is the InChIKey of 5-amino-2-bromo-N-(2,2,2-trifluoroethoxy)benzamide?
The InChIKey is NIXKOZWOAFPUNY-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H8BrF3N2O2/c10-7-2-1-5(14)3-6(7)8(16)15-17-4-9(11,12)13/h1-3H,4,14H2,(H,15,16).
What are the key properties of 5-amino-2-bromo-N-(2,2,2-trifluoroethoxy)benzamide?
5-amino-2-bromo-N-(2,2,2-trifluoroethoxy)benzamide has a molecular weight of 313.07 g/mol, XLogP of 2.26, 3 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5-amino-2-bromo-N-(2,2,2-trifluoroethoxy)benzamide is sourced from PubChem (CID 82721457), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).