C9H10F3NO2S — CID 81339728
2,5-dimethyl-N-(2,2,2-trifluoroethoxy)thiophene-3-carboxamide (PubChem CID 81339728) has the molecular formula C9H10F3NO2S and a molecular weight of 253.24 g/mol. Its IUPAC name is 2,5-dimethyl-N-(2,2,2-trifluoroethoxy)thiophene-3-carboxamide.
| Compound Name | 2,5-dimethyl-N-(2,2,2-trifluoroethoxy)thiophene-3-carboxamide |
|---|---|
| PubChem CID | 81339728 |
| Molecular Formula | C9H10F3NO2S |
| Molecular Weight | 253.24 g/mol |
| Exact Mass | 253.04 |
| IUPAC Name | 2,5-dimethyl-N-(2,2,2-trifluoroethoxy)thiophene-3-carboxamide |
| SMILES | Cc1cc(C(=O)NOCC(F)(F)F)c(C)s1 |
| InChI | InChI=1S/C9H10F3NO2S/c1-5-3-7(6(2)16-5)8(14)13-15-4-9(10,11)12/h3H,4H2,1-2H3,(H,13,14) |
| InChIKey | GVDHDTHCAQGCPS-UHFFFAOYSA-N |
| XLogP | 2.59 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.24 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|