C9H11NO3S — CID 43354495
2-[(2,5-dimethylthiophene-3-carbonyl)amino]acetic acid (PubChem CID 43354495) has the molecular formula C9H11NO3S and a molecular weight of 213.26 g/mol. Its IUPAC name is 2-[(2,5-dimethylthiophene-3-carbonyl)amino]acetic acid.
| Compound Name | 2-[(2,5-dimethylthiophene-3-carbonyl)amino]acetic acid |
|---|---|
| PubChem CID | 43354495 |
| Molecular Formula | C9H11NO3S |
| Molecular Weight | 213.26 g/mol |
| Exact Mass | 213.05 |
| IUPAC Name | 2-[(2,5-dimethylthiophene-3-carbonyl)amino]acetic acid |
| SMILES | Cc1cc(C(=O)NCC(=O)O)c(C)s1 |
| InChI | InChI=1S/C9H11NO3S/c1-5-3-7(6(2)14-5)9(13)10-4-8(11)12/h3H,4H2,1-2H3,(H,10,13)(H,11,12) |
| InChIKey | FUHVFFYLUVNDOU-UHFFFAOYSA-N |
| XLogP | 1.18 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 213.26 |
| LogP ≤ 5 | 1.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |