C11H15NOS — CID 114619039
2,5-dimethyl-N-(2-methylprop-2-enyl)thiophene-3-carboxamide (PubChem CID 114619039) has the molecular formula C11H15NOS and a molecular weight of 209.31 g/mol. Its IUPAC name is 2,5-dimethyl-N-(2-methylprop-2-enyl)thiophene-3-carboxamide.
| Compound Name | 2,5-dimethyl-N-(2-methylprop-2-enyl)thiophene-3-carboxamide |
|---|---|
| PubChem CID | 114619039 |
| Molecular Formula | C11H15NOS |
| Molecular Weight | 209.31 g/mol |
| Exact Mass | 209.09 |
| IUPAC Name | 2,5-dimethyl-N-(2-methylprop-2-enyl)thiophene-3-carboxamide |
| SMILES | C=C(C)CNC(=O)c1cc(C)sc1C |
| InChI | InChI=1S/C11H15NOS/c1-7(2)6-12-11(13)10-5-8(3)14-9(10)4/h5H,1,6H2,2-4H3,(H,12,13) |
| InChIKey | BQASVKDIFLCVLL-UHFFFAOYSA-N |
| XLogP | 2.67 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 209.31 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|