C10H13NOS — CID 114618529
3-methyl-N-(2-methylprop-2-enyl)thiophene-2-carboxamide (PubChem CID 114618529) has the molecular formula C10H13NOS and a molecular weight of 195.29 g/mol. Its IUPAC name is 3-methyl-N-(2-methylprop-2-enyl)thiophene-2-carboxamide.
| Compound Name | 3-methyl-N-(2-methylprop-2-enyl)thiophene-2-carboxamide |
|---|---|
| PubChem CID | 114618529 |
| Molecular Formula | C10H13NOS |
| Molecular Weight | 195.29 g/mol |
| Exact Mass | 195.07 |
| IUPAC Name | 3-methyl-N-(2-methylprop-2-enyl)thiophene-2-carboxamide |
| SMILES | C=C(C)CNC(=O)c1sccc1C |
| InChI | InChI=1S/C10H13NOS/c1-7(2)6-11-10(12)9-8(3)4-5-13-9/h4-5H,1,6H2,2-3H3,(H,11,12) |
| InChIKey | DPRXPEHYYOUUOO-UHFFFAOYSA-N |
| XLogP | 2.36 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 195.29 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|