C11H15NOS — CID 94169217
N-(cyclobutylmethyl)-3-methylthiophene-2-carboxamide (PubChem CID 94169217) has the molecular formula C11H15NOS and a molecular weight of 209.31 g/mol. Its IUPAC name is N-(cyclobutylmethyl)-3-methylthiophene-2-carboxamide.
| Compound Name | N-(cyclobutylmethyl)-3-methylthiophene-2-carboxamide |
|---|---|
| PubChem CID | 94169217 |
| Molecular Formula | C11H15NOS |
| Molecular Weight | 209.31 g/mol |
| Exact Mass | 209.09 |
| IUPAC Name | N-(cyclobutylmethyl)-3-methylthiophene-2-carboxamide |
| SMILES | Cc1ccsc1C(=O)NCC1CCC1 |
| InChI | InChI=1S/C11H15NOS/c1-8-5-6-14-10(8)11(13)12-7-9-3-2-4-9/h5-6,9H,2-4,7H2,1H3,(H,12,13) |
| InChIKey | PCBJZZVGBLLKQJ-UHFFFAOYSA-N |
| XLogP | 2.59 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 209.31 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |