C9H9NOS — CID 39911816
3-methyl-N-prop-2-ynylthiophene-2-carboxamide (PubChem CID 39911816) has the molecular formula C9H9NOS and a molecular weight of 179.24 g/mol. Its IUPAC name is 3-methyl-N-prop-2-ynylthiophene-2-carboxamide.
| Compound Name | 3-methyl-N-prop-2-ynylthiophene-2-carboxamide |
|---|---|
| PubChem CID | 39911816 |
| Molecular Formula | C9H9NOS |
| Molecular Weight | 179.24 g/mol |
| Exact Mass | 179.04 |
| IUPAC Name | 3-methyl-N-prop-2-ynylthiophene-2-carboxamide |
| SMILES | C#CCNC(=O)c1sccc1C |
| InChI | InChI=1S/C9H9NOS/c1-3-5-10-9(11)8-7(2)4-6-12-8/h1,4,6H,5H2,2H3,(H,10,11) |
| InChIKey | JGFQPGLDXZQKEU-UHFFFAOYSA-N |
| XLogP | 1.42 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 179.24 |
| LogP ≤ 5 | 1.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|