C11H16INOS — CID 107322386
N-(5-iodopentyl)-3-methylthiophene-2-carboxamide (PubChem CID 107322386) has the molecular formula C11H16INOS and a molecular weight of 337.23 g/mol. Its IUPAC name is N-(5-iodopentyl)-3-methylthiophene-2-carboxamide.
| Compound Name | N-(5-iodopentyl)-3-methylthiophene-2-carboxamide |
|---|---|
| PubChem CID | 107322386 |
| Molecular Formula | C11H16INOS |
| Molecular Weight | 337.23 g/mol |
| Exact Mass | 337.00 |
| IUPAC Name | N-(5-iodopentyl)-3-methylthiophene-2-carboxamide |
| SMILES | Cc1ccsc1C(=O)NCCCCCI |
| InChI | InChI=1S/C11H16INOS/c1-9-5-8-15-10(9)11(14)13-7-4-2-3-6-12/h5,8H,2-4,6-7H2,1H3,(H,13,14) |
| InChIKey | JKZRYCLQEPCIIV-UHFFFAOYSA-N |
| XLogP | 3.39 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.23 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|