2-[(3-methylthiophene-2-carbonyl)amino]ethyl nitrate

C8H10N2O4S — CID 23367112

IUPAC2-[(3-methylthiophene-2-carbonyl)amino]ethyl nitrate
SMILESCc1ccsc1C(=O)NCCO[N+](=O)[O-]
InChIInChI=1S/C8H10N2O4S/c1-6-2-5-15-7(6)8(11)9-3-4-14-10(12)13/h2,5H,3-4H2,1H3,(H,9,11)
InChIKeyKJNHDVFPLRPHSK-UHFFFAOYSA-N
MW230.24 g/mol
LogP0.99
Rot. Bonds5

About 2-[(3-methylthiophene-2-carbonyl)amino]ethyl nitrate

2-[(3-methylthiophene-2-carbonyl)amino]ethyl nitrate (PubChem CID 23367112) has the molecular formula C8H10N2O4S and a molecular weight of 230.24 g/mol. Its IUPAC name is 2-[(3-methylthiophene-2-carbonyl)amino]ethyl nitrate.

Molecular Properties

Compound Name2-[(3-methylthiophene-2-carbonyl)amino]ethyl nitrate
PubChem CID23367112
Molecular FormulaC8H10N2O4S
Molecular Weight230.24 g/mol
Exact Mass230.04
IUPAC Name2-[(3-methylthiophene-2-carbonyl)amino]ethyl nitrate
SMILESCc1ccsc1C(=O)NCCO[N+](=O)[O-]
InChIInChI=1S/C8H10N2O4S/c1-6-2-5-15-7(6)8(11)9-3-4-14-10(12)13/h2,5H,3-4H2,1H3,(H,9,11)
InChIKeyKJNHDVFPLRPHSK-UHFFFAOYSA-N
XLogP0.99
TPSA81.47 Ų
H-Bond Donors1
H-Bond Acceptors5
Rotatable Bonds5
Heavy Atoms15
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500230.24
LogP ≤ 50.99
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 105

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}

Analyze 2-[(3-methylthiophene-2-carbonyl)amino]ethyl nitrate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-[(3-methylthiophene-2-carbonyl)amino]ethyl nitrate?
The IUPAC name of 2-[(3-methylthiophene-2-carbonyl)amino]ethyl nitrate (CID 23367112) is 2-[(3-methylthiophene-2-carbonyl)amino]ethyl nitrate.
What is the SMILES notation for 2-[(3-methylthiophene-2-carbonyl)amino]ethyl nitrate?
The canonical SMILES for 2-[(3-methylthiophene-2-carbonyl)amino]ethyl nitrate is Cc1ccsc1C(=O)NCCO[N+](=O)[O-].
What is the InChIKey of 2-[(3-methylthiophene-2-carbonyl)amino]ethyl nitrate?
The InChIKey is KJNHDVFPLRPHSK-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H10N2O4S/c1-6-2-5-15-7(6)8(11)9-3-4-14-10(12)13/h2,5H,3-4H2,1H3,(H,9,11).
What are the key properties of 2-[(3-methylthiophene-2-carbonyl)amino]ethyl nitrate?
2-[(3-methylthiophene-2-carbonyl)amino]ethyl nitrate has a molecular weight of 230.24 g/mol, XLogP of 0.99, 5 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(3-methylthiophene-2-carbonyl)amino]ethyl nitrate is sourced from PubChem (CID 23367112), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).