C15H17NOS — CID 31250662
3-methyl-N-[2-(2-methylphenyl)ethyl]thiophene-2-carboxamide (PubChem CID 31250662) has the molecular formula C15H17NOS and a molecular weight of 259.37 g/mol. Its IUPAC name is 3-methyl-N-[2-(2-methylphenyl)ethyl]thiophene-2-carboxamide.
| Compound Name | 3-methyl-N-[2-(2-methylphenyl)ethyl]thiophene-2-carboxamide |
|---|---|
| PubChem CID | 31250662 |
| Molecular Formula | C15H17NOS |
| Molecular Weight | 259.37 g/mol |
| Exact Mass | 259.10 |
| IUPAC Name | 3-methyl-N-[2-(2-methylphenyl)ethyl]thiophene-2-carboxamide |
| SMILES | Cc1ccccc1CCNC(=O)c1sccc1C |
| InChI | InChI=1S/C15H17NOS/c1-11-5-3-4-6-13(11)7-9-16-15(17)14-12(2)8-10-18-14/h3-6,8,10H,7,9H2,1-2H3,(H,16,17) |
| InChIKey | MHTREZNYFCCPOD-UHFFFAOYSA-N |
| XLogP | 3.34 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.37 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |