C13H12ClNOS — CID 2481080
N-[(2-chlorophenyl)methyl]-3-methylthiophene-2-carboxamide (PubChem CID 2481080) has the molecular formula C13H12ClNOS and a molecular weight of 265.76 g/mol. Its IUPAC name is N-[(2-chlorophenyl)methyl]-3-methylthiophene-2-carboxamide.
| Compound Name | N-[(2-chlorophenyl)methyl]-3-methylthiophene-2-carboxamide |
|---|---|
| PubChem CID | 2481080 |
| Molecular Formula | C13H12ClNOS |
| Molecular Weight | 265.76 g/mol |
| Exact Mass | 265.03 |
| IUPAC Name | N-[(2-chlorophenyl)methyl]-3-methylthiophene-2-carboxamide |
| SMILES | Cc1ccsc1C(=O)NCc1ccccc1Cl |
| InChI | InChI=1S/C13H12ClNOS/c1-9-6-7-17-12(9)13(16)15-8-10-4-2-3-5-11(10)14/h2-7H,8H2,1H3,(H,15,16) |
| InChIKey | HOGRKLKPZCHMEE-UHFFFAOYSA-N |
| XLogP | 3.64 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.76 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |