C10H17ClN2OS — CID 119505169
N-[2-(ethylamino)ethyl]-3-methylthiophene-2-carboxamide;hydrochloride (PubChem CID 119505169) has the molecular formula C10H17ClN2OS and a molecular weight of 248.78 g/mol. Its IUPAC name is N-[2-(ethylamino)ethyl]-3-methylthiophene-2-carboxamide;hydrochloride.
| Compound Name | N-[2-(ethylamino)ethyl]-3-methylthiophene-2-carboxamide;hydrochloride |
|---|---|
| PubChem CID | 119505169 |
| Molecular Formula | C10H17ClN2OS |
| Molecular Weight | 248.78 g/mol |
| Exact Mass | 248.08 |
| IUPAC Name | N-[2-(ethylamino)ethyl]-3-methylthiophene-2-carboxamide;hydrochloride |
| SMILES | CCNCCNC(=O)c1sccc1C.Cl |
| InChI | InChI=1S/C10H16N2OS.ClH/c1-3-11-5-6-12-10(13)9-8(2)4-7-14-9;/h4,7,11H,3,5-6H2,1-2H3,(H,12,13);1H |
| InChIKey | GSVVNCZPTFCCKB-UHFFFAOYSA-N |
| XLogP | 1.82 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.78 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|