C15H24N2O3S — CID 71986091
tert-butyl N-[2-methyl-1-[(3-methylthiophene-2-carbonyl)amino]propan-2-yl]carbamate (PubChem CID 71986091) has the molecular formula C15H24N2O3S and a molecular weight of 312.44 g/mol. Its IUPAC name is tert-butyl N-[2-methyl-1-[(3-methylthiophene-2-carbonyl)amino]propan-2-yl]carbamate.
| Compound Name | tert-butyl N-[2-methyl-1-[(3-methylthiophene-2-carbonyl)amino]propan-2-yl]carbamate |
|---|---|
| PubChem CID | 71986091 |
| Molecular Formula | C15H24N2O3S |
| Molecular Weight | 312.44 g/mol |
| Exact Mass | 312.15 |
| IUPAC Name | tert-butyl N-[2-methyl-1-[(3-methylthiophene-2-carbonyl)amino]propan-2-yl]carbamate |
| SMILES | Cc1ccsc1C(=O)NCC(C)(C)NC(=O)OC(C)(C)C |
| InChI | InChI=1S/C15H24N2O3S/c1-10-7-8-21-11(10)12(18)16-9-15(5,6)17-13(19)20-14(2,3)4/h7-8H,9H2,1-6H3,(H,16,18)(H,17,19) |
| InChIKey | FGDQETJDZYMULP-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.44 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |