C16H26N2O3S — CID 95933406
tert-butyl N-[2-methyl-1-[[(2R)-2-thiophen-2-ylpropanoyl]amino]propan-2-yl]carbamate (PubChem CID 95933406) has the molecular formula C16H26N2O3S and a molecular weight of 326.46 g/mol. Its IUPAC name is tert-butyl N-[2-methyl-1-[[(2R)-2-thiophen-2-ylpropanoyl]amino]propan-2-yl]carbamate.
| Compound Name | tert-butyl N-[2-methyl-1-[[(2R)-2-thiophen-2-ylpropanoyl]amino]propan-2-yl]carbamate |
|---|---|
| PubChem CID | 95933406 |
| Molecular Formula | C16H26N2O3S |
| Molecular Weight | 326.46 g/mol |
| Exact Mass | 326.17 |
| IUPAC Name | tert-butyl N-[2-methyl-1-[[(2R)-2-thiophen-2-ylpropanoyl]amino]propan-2-yl]carbamate |
| SMILES | C[C@H](C(=O)NCC(C)(C)NC(=O)OC(C)(C)C)c1cccs1 |
| InChI | InChI=1S/C16H26N2O3S/c1-11(12-8-7-9-22-12)13(19)17-10-16(5,6)18-14(20)21-15(2,3)4/h7-9,11H,10H2,1-6H3,(H,17,19)(H,18,20)/t11-/m0/s1 |
| InChIKey | CTYVGPGAIQEJBI-NSHDSACASA-N |
| XLogP | 3.27 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.46 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |