C14H17NO2S2 — CID 111451994
N-(2-hydroxy-2-thiophen-3-ylpropyl)-2-thiophen-2-ylpropanamide (PubChem CID 111451994) has the molecular formula C14H17NO2S2 and a molecular weight of 295.43 g/mol. Its IUPAC name is N-(2-hydroxy-2-thiophen-3-ylpropyl)-2-thiophen-2-ylpropanamide.
| Compound Name | N-(2-hydroxy-2-thiophen-3-ylpropyl)-2-thiophen-2-ylpropanamide |
|---|---|
| PubChem CID | 111451994 |
| Molecular Formula | C14H17NO2S2 |
| Molecular Weight | 295.43 g/mol |
| Exact Mass | 295.07 |
| IUPAC Name | N-(2-hydroxy-2-thiophen-3-ylpropyl)-2-thiophen-2-ylpropanamide |
| SMILES | CC(C(=O)NCC(C)(O)c1ccsc1)c1cccs1 |
| InChI | InChI=1S/C14H17NO2S2/c1-10(12-4-3-6-19-12)13(16)15-9-14(2,17)11-5-7-18-8-11/h3-8,10,17H,9H2,1-2H3,(H,15,16) |
| InChIKey | CQFPQJHYOIMRQR-UHFFFAOYSA-N |
| XLogP | 2.94 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.43 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |