C17H21NO2S2 — CID 111720061
N-(2-hydroxy-2-thiophen-3-ylpropyl)-2-methyl-3-phenylsulfanylpropanamide (PubChem CID 111720061) has the molecular formula C17H21NO2S2 and a molecular weight of 335.49 g/mol. Its IUPAC name is N-(2-hydroxy-2-thiophen-3-ylpropyl)-2-methyl-3-phenylsulfanylpropanamide.
| Compound Name | N-(2-hydroxy-2-thiophen-3-ylpropyl)-2-methyl-3-phenylsulfanylpropanamide |
|---|---|
| PubChem CID | 111720061 |
| Molecular Formula | C17H21NO2S2 |
| Molecular Weight | 335.49 g/mol |
| Exact Mass | 335.10 |
| IUPAC Name | N-(2-hydroxy-2-thiophen-3-ylpropyl)-2-methyl-3-phenylsulfanylpropanamide |
| SMILES | CC(CSc1ccccc1)C(=O)NCC(C)(O)c1ccsc1 |
| InChI | InChI=1S/C17H21NO2S2/c1-13(10-22-15-6-4-3-5-7-15)16(19)18-12-17(2,20)14-8-9-21-11-14/h3-9,11,13,20H,10,12H2,1-2H3,(H,18,19) |
| InChIKey | OFJPRMXBONWGQF-UHFFFAOYSA-N |
| XLogP | 3.50 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.49 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |