C16H20N2O2S — CID 111451848
N-(2-hydroxy-2-thiophen-3-ylpropyl)-2-(N-methylanilino)acetamide (PubChem CID 111451848) has the molecular formula C16H20N2O2S and a molecular weight of 304.42 g/mol. Its IUPAC name is N-(2-hydroxy-2-thiophen-3-ylpropyl)-2-(N-methylanilino)acetamide.
| Compound Name | N-(2-hydroxy-2-thiophen-3-ylpropyl)-2-(N-methylanilino)acetamide |
|---|---|
| PubChem CID | 111451848 |
| Molecular Formula | C16H20N2O2S |
| Molecular Weight | 304.42 g/mol |
| Exact Mass | 304.12 |
| IUPAC Name | N-(2-hydroxy-2-thiophen-3-ylpropyl)-2-(N-methylanilino)acetamide |
| SMILES | CN(CC(=O)NCC(C)(O)c1ccsc1)c1ccccc1 |
| InChI | InChI=1S/C16H20N2O2S/c1-16(20,13-8-9-21-11-13)12-17-15(19)10-18(2)14-6-4-3-5-7-14/h3-9,11,20H,10,12H2,1-2H3,(H,17,19) |
| InChIKey | NBGVXVWNOLVWJH-UHFFFAOYSA-N |
| XLogP | 2.21 |
| TPSA | 52.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.42 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |