C16H17N5O2S — CID 96567083
N-[(2R)-2-hydroxy-2-thiophen-3-ylpropyl]-2-(5-phenyltetrazol-2-yl)acetamide (PubChem CID 96567083) has the molecular formula C16H17N5O2S and a molecular weight of 343.41 g/mol. Its IUPAC name is N-[(2R)-2-hydroxy-2-thiophen-3-ylpropyl]-2-(5-phenyltetrazol-2-yl)acetamide.
| Compound Name | N-[(2R)-2-hydroxy-2-thiophen-3-ylpropyl]-2-(5-phenyltetrazol-2-yl)acetamide |
|---|---|
| PubChem CID | 96567083 |
| Molecular Formula | C16H17N5O2S |
| Molecular Weight | 343.41 g/mol |
| Exact Mass | 343.11 |
| IUPAC Name | N-[(2R)-2-hydroxy-2-thiophen-3-ylpropyl]-2-(5-phenyltetrazol-2-yl)acetamide |
| SMILES | C[C@](O)(CNC(=O)Cn1nnc(-c2ccccc2)n1)c1ccsc1 |
| InChI | InChI=1S/C16H17N5O2S/c1-16(23,13-7-8-24-10-13)11-17-14(22)9-21-19-15(18-20-21)12-5-3-2-4-6-12/h2-8,10,23H,9,11H2,1H3,(H,17,22)/t16-/m0/s1 |
| InChIKey | RYWQGGPYENEQJM-INIZCTEOSA-N |
| XLogP | 1.43 |
| TPSA | 92.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.41 |
| LogP ≤ 5 | 1.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |