C16H17N5O3 — CID 97319859
2-[5-(furan-2-yl)tetrazol-2-yl]-N-[(2S)-2-hydroxy-2-phenylpropyl]acetamide (PubChem CID 97319859) has the molecular formula C16H17N5O3 and a molecular weight of 327.34 g/mol. Its IUPAC name is 2-[5-(furan-2-yl)tetrazol-2-yl]-N-[(2S)-2-hydroxy-2-phenylpropyl]acetamide.
| Compound Name | 2-[5-(furan-2-yl)tetrazol-2-yl]-N-[(2S)-2-hydroxy-2-phenylpropyl]acetamide |
|---|---|
| PubChem CID | 97319859 |
| Molecular Formula | C16H17N5O3 |
| Molecular Weight | 327.34 g/mol |
| Exact Mass | 327.13 |
| IUPAC Name | 2-[5-(furan-2-yl)tetrazol-2-yl]-N-[(2S)-2-hydroxy-2-phenylpropyl]acetamide |
| SMILES | C[C@@](O)(CNC(=O)Cn1nnc(-c2ccco2)n1)c1ccccc1 |
| InChI | InChI=1S/C16H17N5O3/c1-16(23,12-6-3-2-4-7-12)11-17-14(22)10-21-19-15(18-20-21)13-8-5-9-24-13/h2-9,23H,10-11H2,1H3,(H,17,22)/t16-/m1/s1 |
| InChIKey | ZEWIJRBAOZDYQC-MRXNPFEDSA-N |
| XLogP | 0.96 |
| TPSA | 106.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.34 |
| LogP ≤ 5 | 0.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |