C12H15N5O4 — CID 61007120
3-[ethyl-[2-[5-(furan-2-yl)tetrazol-2-yl]acetyl]amino]propanoic acid (PubChem CID 61007120) has the molecular formula C12H15N5O4 and a molecular weight of 293.28 g/mol. Its IUPAC name is 3-[ethyl-[2-[5-(furan-2-yl)tetrazol-2-yl]acetyl]amino]propanoic acid.
| Compound Name | 3-[ethyl-[2-[5-(furan-2-yl)tetrazol-2-yl]acetyl]amino]propanoic acid |
|---|---|
| PubChem CID | 61007120 |
| Molecular Formula | C12H15N5O4 |
| Molecular Weight | 293.28 g/mol |
| Exact Mass | 293.11 |
| IUPAC Name | 3-[ethyl-[2-[5-(furan-2-yl)tetrazol-2-yl]acetyl]amino]propanoic acid |
| SMILES | CCN(CCC(=O)O)C(=O)Cn1nnc(-c2ccco2)n1 |
| InChI | InChI=1S/C12H15N5O4/c1-2-16(6-5-11(19)20)10(18)8-17-14-12(13-15-17)9-4-3-7-21-9/h3-4,7H,2,5-6,8H2,1H3,(H,19,20) |
| InChIKey | YPYBZFMPNMEIET-UHFFFAOYSA-N |
| XLogP | 0.26 |
| TPSA | 114.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.28 |
| LogP ≤ 5 | 0.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |