C13H19N5O3 — CID 103771124
2-[5-(furan-2-yl)tetrazol-2-yl]-N-(2-hydroxy-4-methylpentyl)acetamide (PubChem CID 103771124) has the molecular formula C13H19N5O3 and a molecular weight of 293.33 g/mol. Its IUPAC name is 2-[5-(furan-2-yl)tetrazol-2-yl]-N-(2-hydroxy-4-methylpentyl)acetamide.
| Compound Name | 2-[5-(furan-2-yl)tetrazol-2-yl]-N-(2-hydroxy-4-methylpentyl)acetamide |
|---|---|
| PubChem CID | 103771124 |
| Molecular Formula | C13H19N5O3 |
| Molecular Weight | 293.33 g/mol |
| Exact Mass | 293.15 |
| IUPAC Name | 2-[5-(furan-2-yl)tetrazol-2-yl]-N-(2-hydroxy-4-methylpentyl)acetamide |
| SMILES | CC(C)CC(O)CNC(=O)Cn1nnc(-c2ccco2)n1 |
| InChI | InChI=1S/C13H19N5O3/c1-9(2)6-10(19)7-14-12(20)8-18-16-13(15-17-18)11-4-3-5-21-11/h3-5,9-10,19H,6-8H2,1-2H3,(H,14,20) |
| InChIKey | GPTXKLXNHPTINM-UHFFFAOYSA-N |
| XLogP | 0.46 |
| TPSA | 106.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.33 |
| LogP ≤ 5 | 0.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |