C11H13N5O5 — CID 81084981
2-[[2-[5-(furan-2-yl)tetrazol-2-yl]acetyl]amino]-3-methoxypropanoic acid (PubChem CID 81084981) has the molecular formula C11H13N5O5 and a molecular weight of 295.25 g/mol. Its IUPAC name is 2-[[2-[5-(furan-2-yl)tetrazol-2-yl]acetyl]amino]-3-methoxypropanoic acid.
| Compound Name | 2-[[2-[5-(furan-2-yl)tetrazol-2-yl]acetyl]amino]-3-methoxypropanoic acid |
|---|---|
| PubChem CID | 81084981 |
| Molecular Formula | C11H13N5O5 |
| Molecular Weight | 295.25 g/mol |
| Exact Mass | 295.09 |
| IUPAC Name | 2-[[2-[5-(furan-2-yl)tetrazol-2-yl]acetyl]amino]-3-methoxypropanoic acid |
| SMILES | COCC(NC(=O)Cn1nnc(-c2ccco2)n1)C(=O)O |
| InChI | InChI=1S/C11H13N5O5/c1-20-6-7(11(18)19)12-9(17)5-16-14-10(13-15-16)8-3-2-4-21-8/h2-4,7H,5-6H2,1H3,(H,12,17)(H,18,19) |
| InChIKey | ZCTKGDUHOZQWIZ-UHFFFAOYSA-N |
| XLogP | -0.85 |
| TPSA | 132.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.25 |
| LogP ≤ 5 | -0.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |