C12H15N5O3 — CID 115643437
2-[5-(furan-2-yl)tetrazol-2-yl]-N-[(1-hydroxycyclobutyl)methyl]acetamide (PubChem CID 115643437) has the molecular formula C12H15N5O3 and a molecular weight of 277.28 g/mol. Its IUPAC name is 2-[5-(furan-2-yl)tetrazol-2-yl]-N-[(1-hydroxycyclobutyl)methyl]acetamide.
| Compound Name | 2-[5-(furan-2-yl)tetrazol-2-yl]-N-[(1-hydroxycyclobutyl)methyl]acetamide |
|---|---|
| PubChem CID | 115643437 |
| Molecular Formula | C12H15N5O3 |
| Molecular Weight | 277.28 g/mol |
| Exact Mass | 277.12 |
| IUPAC Name | 2-[5-(furan-2-yl)tetrazol-2-yl]-N-[(1-hydroxycyclobutyl)methyl]acetamide |
| SMILES | O=C(Cn1nnc(-c2ccco2)n1)NCC1(O)CCC1 |
| InChI | InChI=1S/C12H15N5O3/c18-10(13-8-12(19)4-2-5-12)7-17-15-11(14-16-17)9-3-1-6-20-9/h1,3,6,19H,2,4-5,7-8H2,(H,13,18) |
| InChIKey | HMCKFFFTOZHWDR-UHFFFAOYSA-N |
| XLogP | -0.04 |
| TPSA | 106.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.28 |
| LogP ≤ 5 | -0.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |