C16H21N5O2 — CID 111445934
N-[(1-hydroxycyclohexyl)methyl]-2-(5-phenyltetrazol-2-yl)acetamide (PubChem CID 111445934) has the molecular formula C16H21N5O2 and a molecular weight of 315.38 g/mol. Its IUPAC name is N-[(1-hydroxycyclohexyl)methyl]-2-(5-phenyltetrazol-2-yl)acetamide.
| Compound Name | N-[(1-hydroxycyclohexyl)methyl]-2-(5-phenyltetrazol-2-yl)acetamide |
|---|---|
| PubChem CID | 111445934 |
| Molecular Formula | C16H21N5O2 |
| Molecular Weight | 315.38 g/mol |
| Exact Mass | 315.17 |
| IUPAC Name | N-[(1-hydroxycyclohexyl)methyl]-2-(5-phenyltetrazol-2-yl)acetamide |
| SMILES | O=C(Cn1nnc(-c2ccccc2)n1)NCC1(O)CCCCC1 |
| InChI | InChI=1S/C16H21N5O2/c22-14(17-12-16(23)9-5-2-6-10-16)11-21-19-15(18-20-21)13-7-3-1-4-8-13/h1,3-4,7-8,23H,2,5-6,9-12H2,(H,17,22) |
| InChIKey | YUZIVQPNUKCTMF-UHFFFAOYSA-N |
| XLogP | 1.15 |
| TPSA | 92.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.38 |
| LogP ≤ 5 | 1.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |