C15H16N6O — CID 4825124
N-(1-cyanocyclopentyl)-2-(5-phenyltetrazol-2-yl)acetamide (PubChem CID 4825124) has the molecular formula C15H16N6O and a molecular weight of 296.33 g/mol. Its IUPAC name is N-(1-cyanocyclopentyl)-2-(5-phenyltetrazol-2-yl)acetamide.
| Compound Name | N-(1-cyanocyclopentyl)-2-(5-phenyltetrazol-2-yl)acetamide |
|---|---|
| PubChem CID | 4825124 |
| Molecular Formula | C15H16N6O |
| Molecular Weight | 296.33 g/mol |
| Exact Mass | 296.14 |
| IUPAC Name | N-(1-cyanocyclopentyl)-2-(5-phenyltetrazol-2-yl)acetamide |
| SMILES | N#CC1(NC(=O)Cn2nnc(-c3ccccc3)n2)CCCC1 |
| InChI | InChI=1S/C15H16N6O/c16-11-15(8-4-5-9-15)17-13(22)10-21-19-14(18-20-21)12-6-2-1-3-7-12/h1-3,6-7H,4-5,8-10H2,(H,17,22) |
| InChIKey | MSHILQVMGUURTL-UHFFFAOYSA-N |
| XLogP | 1.29 |
| TPSA | 96.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.33 |
| LogP ≤ 5 | 1.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |