C17H20N6O — CID 26571918
N-(1-cyanocyclohexyl)-N-methyl-2-(5-phenyltetrazol-2-yl)acetamide (PubChem CID 26571918) has the molecular formula C17H20N6O and a molecular weight of 324.39 g/mol. Its IUPAC name is N-(1-cyanocyclohexyl)-N-methyl-2-(5-phenyltetrazol-2-yl)acetamide.
| Compound Name | N-(1-cyanocyclohexyl)-N-methyl-2-(5-phenyltetrazol-2-yl)acetamide |
|---|---|
| PubChem CID | 26571918 |
| Molecular Formula | C17H20N6O |
| Molecular Weight | 324.39 g/mol |
| Exact Mass | 324.17 |
| IUPAC Name | N-(1-cyanocyclohexyl)-N-methyl-2-(5-phenyltetrazol-2-yl)acetamide |
| SMILES | CN(C(=O)Cn1nnc(-c2ccccc2)n1)C1(C#N)CCCCC1 |
| InChI | InChI=1S/C17H20N6O/c1-22(17(13-18)10-6-3-7-11-17)15(24)12-23-20-16(19-21-23)14-8-4-2-5-9-14/h2,4-5,8-9H,3,6-7,10-12H2,1H3 |
| InChIKey | SAAQLXJDFMCTRO-UHFFFAOYSA-N |
| XLogP | 2.02 |
| TPSA | 87.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.39 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |