C17H14N6O — CID 3995748
N-[4-(cyanomethyl)phenyl]-2-(5-phenyltetrazol-2-yl)acetamide (PubChem CID 3995748) has the molecular formula C17H14N6O and a molecular weight of 318.34 g/mol. Its IUPAC name is N-[4-(cyanomethyl)phenyl]-2-(5-phenyltetrazol-2-yl)acetamide.
| Compound Name | N-[4-(cyanomethyl)phenyl]-2-(5-phenyltetrazol-2-yl)acetamide |
|---|---|
| PubChem CID | 3995748 |
| Molecular Formula | C17H14N6O |
| Molecular Weight | 318.34 g/mol |
| Exact Mass | 318.12 |
| IUPAC Name | N-[4-(cyanomethyl)phenyl]-2-(5-phenyltetrazol-2-yl)acetamide |
| SMILES | N#CCc1ccc(NC(=O)Cn2nnc(-c3ccccc3)n2)cc1 |
| InChI | InChI=1S/C17H14N6O/c18-11-10-13-6-8-15(9-7-13)19-16(24)12-23-21-17(20-22-23)14-4-2-1-3-5-14/h1-9H,10,12H2,(H,19,24) |
| InChIKey | OFRHBJCIGYLBLU-UHFFFAOYSA-N |
| XLogP | 2.04 |
| TPSA | 96.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.34 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |