C12H15N5O3 — CID 63294953
N-(2-cyclopropyl-2-hydroxyethyl)-2-[5-(furan-2-yl)tetrazol-2-yl]acetamide (PubChem CID 63294953) has the molecular formula C12H15N5O3 and a molecular weight of 277.28 g/mol. Its IUPAC name is N-(2-cyclopropyl-2-hydroxyethyl)-2-[5-(furan-2-yl)tetrazol-2-yl]acetamide.
| Compound Name | N-(2-cyclopropyl-2-hydroxyethyl)-2-[5-(furan-2-yl)tetrazol-2-yl]acetamide |
|---|---|
| PubChem CID | 63294953 |
| Molecular Formula | C12H15N5O3 |
| Molecular Weight | 277.28 g/mol |
| Exact Mass | 277.12 |
| IUPAC Name | N-(2-cyclopropyl-2-hydroxyethyl)-2-[5-(furan-2-yl)tetrazol-2-yl]acetamide |
| SMILES | O=C(Cn1nnc(-c2ccco2)n1)NCC(O)C1CC1 |
| InChI | InChI=1S/C12H15N5O3/c18-9(8-3-4-8)6-13-11(19)7-17-15-12(14-16-17)10-2-1-5-20-10/h1-2,5,8-9,18H,3-4,6-7H2,(H,13,19) |
| InChIKey | BHQZXBYWXINGDA-UHFFFAOYSA-N |
| XLogP | -0.18 |
| TPSA | 106.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.28 |
| LogP ≤ 5 | -0.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |