C14H15NO2S — CID 111451803
N-(2-hydroxy-2-thiophen-3-ylpropyl)benzamide (PubChem CID 111451803) has the molecular formula C14H15NO2S and a molecular weight of 261.35 g/mol. Its IUPAC name is N-(2-hydroxy-2-thiophen-3-ylpropyl)benzamide.
| Compound Name | N-(2-hydroxy-2-thiophen-3-ylpropyl)benzamide |
|---|---|
| PubChem CID | 111451803 |
| Molecular Formula | C14H15NO2S |
| Molecular Weight | 261.35 g/mol |
| Exact Mass | 261.08 |
| IUPAC Name | N-(2-hydroxy-2-thiophen-3-ylpropyl)benzamide |
| SMILES | CC(O)(CNC(=O)c1ccccc1)c1ccsc1 |
| InChI | InChI=1S/C14H15NO2S/c1-14(17,12-7-8-18-9-12)10-15-13(16)11-5-3-2-4-6-11/h2-9,17H,10H2,1H3,(H,15,16) |
| InChIKey | ZNCHFLNHVCGUNM-UHFFFAOYSA-N |
| XLogP | 2.39 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.35 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |