C14H13Cl2NO2S — CID 111452323
3,4-dichloro-N-(2-hydroxy-2-thiophen-3-ylpropyl)benzamide (PubChem CID 111452323) has the molecular formula C14H13Cl2NO2S and a molecular weight of 330.24 g/mol. Its IUPAC name is 3,4-dichloro-N-(2-hydroxy-2-thiophen-3-ylpropyl)benzamide.
| Compound Name | 3,4-dichloro-N-(2-hydroxy-2-thiophen-3-ylpropyl)benzamide |
|---|---|
| PubChem CID | 111452323 |
| Molecular Formula | C14H13Cl2NO2S |
| Molecular Weight | 330.24 g/mol |
| Exact Mass | 329.00 |
| IUPAC Name | 3,4-dichloro-N-(2-hydroxy-2-thiophen-3-ylpropyl)benzamide |
| SMILES | CC(O)(CNC(=O)c1ccc(Cl)c(Cl)c1)c1ccsc1 |
| InChI | InChI=1S/C14H13Cl2NO2S/c1-14(19,10-4-5-20-7-10)8-17-13(18)9-2-3-11(15)12(16)6-9/h2-7,19H,8H2,1H3,(H,17,18) |
| InChIKey | CFOMUXUPCJOHBJ-UHFFFAOYSA-N |
| XLogP | 3.69 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.24 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |