C15H13F4NO2S — CID 111452010
4-fluoro-N-(2-hydroxy-2-thiophen-3-ylpropyl)-3-(trifluoromethyl)benzamide (PubChem CID 111452010) has the molecular formula C15H13F4NO2S and a molecular weight of 347.33 g/mol. Its IUPAC name is 4-fluoro-N-(2-hydroxy-2-thiophen-3-ylpropyl)-3-(trifluoromethyl)benzamide.
| Compound Name | 4-fluoro-N-(2-hydroxy-2-thiophen-3-ylpropyl)-3-(trifluoromethyl)benzamide |
|---|---|
| PubChem CID | 111452010 |
| Molecular Formula | C15H13F4NO2S |
| Molecular Weight | 347.33 g/mol |
| Exact Mass | 347.06 |
| IUPAC Name | 4-fluoro-N-(2-hydroxy-2-thiophen-3-ylpropyl)-3-(trifluoromethyl)benzamide |
| SMILES | CC(O)(CNC(=O)c1ccc(F)c(C(F)(F)F)c1)c1ccsc1 |
| InChI | InChI=1S/C15H13F4NO2S/c1-14(22,10-4-5-23-7-10)8-20-13(21)9-2-3-12(16)11(6-9)15(17,18)19/h2-7,22H,8H2,1H3,(H,20,21) |
| InChIKey | PIBZAOUIBWEXST-UHFFFAOYSA-N |
| XLogP | 3.54 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.33 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |