C13H21NO2S — CID 111452236
N-(2-hydroxy-2-thiophen-3-ylpropyl)-3,3-dimethylbutanamide (PubChem CID 111452236) has the molecular formula C13H21NO2S and a molecular weight of 255.38 g/mol. Its IUPAC name is N-(2-hydroxy-2-thiophen-3-ylpropyl)-3,3-dimethylbutanamide.
| Compound Name | N-(2-hydroxy-2-thiophen-3-ylpropyl)-3,3-dimethylbutanamide |
|---|---|
| PubChem CID | 111452236 |
| Molecular Formula | C13H21NO2S |
| Molecular Weight | 255.38 g/mol |
| Exact Mass | 255.13 |
| IUPAC Name | N-(2-hydroxy-2-thiophen-3-ylpropyl)-3,3-dimethylbutanamide |
| SMILES | CC(C)(C)CC(=O)NCC(C)(O)c1ccsc1 |
| InChI | InChI=1S/C13H21NO2S/c1-12(2,3)7-11(15)14-9-13(4,16)10-5-6-17-8-10/h5-6,8,16H,7,9H2,1-4H3,(H,14,15) |
| InChIKey | FZNAAIZSTJUMNW-UHFFFAOYSA-N |
| XLogP | 2.51 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.38 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |