C16H24N2O3S — CID 109477004
N'-cyclopentyl-N-(2-hydroxy-2-thiophen-3-ylpropyl)butanediamide (PubChem CID 109477004) has the molecular formula C16H24N2O3S and a molecular weight of 324.45 g/mol. Its IUPAC name is N'-cyclopentyl-N-(2-hydroxy-2-thiophen-3-ylpropyl)butanediamide.
| Compound Name | N'-cyclopentyl-N-(2-hydroxy-2-thiophen-3-ylpropyl)butanediamide |
|---|---|
| PubChem CID | 109477004 |
| Molecular Formula | C16H24N2O3S |
| Molecular Weight | 324.45 g/mol |
| Exact Mass | 324.15 |
| IUPAC Name | N'-cyclopentyl-N-(2-hydroxy-2-thiophen-3-ylpropyl)butanediamide |
| SMILES | CC(O)(CNC(=O)CCC(=O)NC1CCCC1)c1ccsc1 |
| InChI | InChI=1S/C16H24N2O3S/c1-16(21,12-8-9-22-10-12)11-17-14(19)6-7-15(20)18-13-4-2-3-5-13/h8-10,13,21H,2-7,11H2,1H3,(H,17,19)(H,18,20) |
| InChIKey | IEYKULKUEIBGGX-UHFFFAOYSA-N |
| XLogP | 1.91 |
| TPSA | 78.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.45 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |