C16H17F2NO2S — CID 111452290
3-(3,4-difluorophenyl)-N-(2-hydroxy-2-thiophen-3-ylpropyl)propanamide (PubChem CID 111452290) has the molecular formula C16H17F2NO2S and a molecular weight of 325.38 g/mol. Its IUPAC name is 3-(3,4-difluorophenyl)-N-(2-hydroxy-2-thiophen-3-ylpropyl)propanamide.
| Compound Name | 3-(3,4-difluorophenyl)-N-(2-hydroxy-2-thiophen-3-ylpropyl)propanamide |
|---|---|
| PubChem CID | 111452290 |
| Molecular Formula | C16H17F2NO2S |
| Molecular Weight | 325.38 g/mol |
| Exact Mass | 325.09 |
| IUPAC Name | 3-(3,4-difluorophenyl)-N-(2-hydroxy-2-thiophen-3-ylpropyl)propanamide |
| SMILES | CC(O)(CNC(=O)CCc1ccc(F)c(F)c1)c1ccsc1 |
| InChI | InChI=1S/C16H17F2NO2S/c1-16(21,12-6-7-22-9-12)10-19-15(20)5-3-11-2-4-13(17)14(18)8-11/h2,4,6-9,21H,3,5,10H2,1H3,(H,19,20) |
| InChIKey | NETIHAJCMBWNNG-UHFFFAOYSA-N |
| XLogP | 2.98 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.38 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |