C13H15NO2S2 — CID 111452322
N-(2-hydroxy-2-thiophen-3-ylpropyl)-3-methylthiophene-2-carboxamide (PubChem CID 111452322) has the molecular formula C13H15NO2S2 and a molecular weight of 281.40 g/mol. Its IUPAC name is N-(2-hydroxy-2-thiophen-3-ylpropyl)-3-methylthiophene-2-carboxamide.
| Compound Name | N-(2-hydroxy-2-thiophen-3-ylpropyl)-3-methylthiophene-2-carboxamide |
|---|---|
| PubChem CID | 111452322 |
| Molecular Formula | C13H15NO2S2 |
| Molecular Weight | 281.40 g/mol |
| Exact Mass | 281.05 |
| IUPAC Name | N-(2-hydroxy-2-thiophen-3-ylpropyl)-3-methylthiophene-2-carboxamide |
| SMILES | Cc1ccsc1C(=O)NCC(C)(O)c1ccsc1 |
| InChI | InChI=1S/C13H15NO2S2/c1-9-3-6-18-11(9)12(15)14-8-13(2,16)10-4-5-17-7-10/h3-7,16H,8H2,1-2H3,(H,14,15) |
| InChIKey | ZWYQWDWKVYUXSO-UHFFFAOYSA-N |
| XLogP | 2.76 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.40 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |