C10H12ClNOS — CID 103403010
3-chloro-4-methyl-N-(2-methylprop-2-enyl)thiophene-2-carboxamide (PubChem CID 103403010) has the molecular formula C10H12ClNOS and a molecular weight of 229.73 g/mol. Its IUPAC name is 3-chloro-4-methyl-N-(2-methylprop-2-enyl)thiophene-2-carboxamide.
| Compound Name | 3-chloro-4-methyl-N-(2-methylprop-2-enyl)thiophene-2-carboxamide |
|---|---|
| PubChem CID | 103403010 |
| Molecular Formula | C10H12ClNOS |
| Molecular Weight | 229.73 g/mol |
| Exact Mass | 229.03 |
| IUPAC Name | 3-chloro-4-methyl-N-(2-methylprop-2-enyl)thiophene-2-carboxamide |
| SMILES | C=C(C)CNC(=O)c1scc(C)c1Cl |
| InChI | InChI=1S/C10H12ClNOS/c1-6(2)4-12-10(13)9-8(11)7(3)5-14-9/h5H,1,4H2,2-3H3,(H,12,13) |
| InChIKey | QRENRMFIRKMYAZ-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 229.73 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|