C9H12N2OS — CID 114618761
4-methyl-N-(2-methylprop-2-enyl)-1,3-thiazole-5-carboxamide (PubChem CID 114618761) has the molecular formula C9H12N2OS and a molecular weight of 196.27 g/mol. Its IUPAC name is 4-methyl-N-(2-methylprop-2-enyl)-1,3-thiazole-5-carboxamide.
| Compound Name | 4-methyl-N-(2-methylprop-2-enyl)-1,3-thiazole-5-carboxamide |
|---|---|
| PubChem CID | 114618761 |
| Molecular Formula | C9H12N2OS |
| Molecular Weight | 196.27 g/mol |
| Exact Mass | 196.07 |
| IUPAC Name | 4-methyl-N-(2-methylprop-2-enyl)-1,3-thiazole-5-carboxamide |
| SMILES | C=C(C)CNC(=O)c1scnc1C |
| InChI | InChI=1S/C9H12N2OS/c1-6(2)4-10-9(12)8-7(3)11-5-13-8/h5H,1,4H2,2-3H3,(H,10,12) |
| InChIKey | DYFGGEVZCPPOLK-UHFFFAOYSA-N |
| XLogP | 1.76 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 196.27 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|