C10H13NOS — CID 105129903
4-methyl-1-(4-methyl-1,3-thiazol-5-yl)pent-4-en-1-one (PubChem CID 105129903) has the molecular formula C10H13NOS and a molecular weight of 195.29 g/mol. Its IUPAC name is 4-methyl-1-(4-methyl-1,3-thiazol-5-yl)pent-4-en-1-one.
| Compound Name | 4-methyl-1-(4-methyl-1,3-thiazol-5-yl)pent-4-en-1-one |
|---|---|
| PubChem CID | 105129903 |
| Molecular Formula | C10H13NOS |
| Molecular Weight | 195.29 g/mol |
| Exact Mass | 195.07 |
| IUPAC Name | 4-methyl-1-(4-methyl-1,3-thiazol-5-yl)pent-4-en-1-one |
| SMILES | C=C(C)CCC(=O)c1scnc1C |
| InChI | InChI=1S/C10H13NOS/c1-7(2)4-5-9(12)10-8(3)11-6-13-10/h6H,1,4-5H2,2-3H3 |
| InChIKey | JEDZSTMOSOOHNQ-UHFFFAOYSA-N |
| XLogP | 2.99 |
| TPSA | 29.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 195.29 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|