C9H11NS — CID 139497992
4-methyl-5-[(3Z)-penta-1,3-dien-2-yl]-1,3-thiazole (PubChem CID 139497992) has the molecular formula C9H11NS and a molecular weight of 165.26 g/mol. Its IUPAC name is 4-methyl-5-[(3Z)-penta-1,3-dien-2-yl]-1,3-thiazole.
| Compound Name | 4-methyl-5-[(3Z)-penta-1,3-dien-2-yl]-1,3-thiazole |
|---|---|
| PubChem CID | 139497992 |
| Molecular Formula | C9H11NS |
| Molecular Weight | 165.26 g/mol |
| Exact Mass | 165.06 |
| IUPAC Name | 4-methyl-5-[(3Z)-penta-1,3-dien-2-yl]-1,3-thiazole |
| SMILES | C=C(/C=C\C)c1scnc1C |
| InChI | InChI=1S/C9H11NS/c1-4-5-7(2)9-8(3)10-6-11-9/h4-6H,2H2,1,3H3/b5-4- |
| InChIKey | RKJITFHPXRPYMJ-PLNGDYQASA-N |
| XLogP | 3.04 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 165.26 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|