C11H19NO2SSi — CID 91732954
[tert-butyl(dimethyl)silyl] 4-methyl-1,3-thiazole-5-carboxylate (PubChem CID 91732954) has the molecular formula C11H19NO2SSi and a molecular weight of 257.43 g/mol. Its IUPAC name is [tert-butyl(dimethyl)silyl] 4-methyl-1,3-thiazole-5-carboxylate.
| Compound Name | [tert-butyl(dimethyl)silyl] 4-methyl-1,3-thiazole-5-carboxylate |
|---|---|
| PubChem CID | 91732954 |
| Molecular Formula | C11H19NO2SSi |
| Molecular Weight | 257.43 g/mol |
| Exact Mass | 257.09 |
| IUPAC Name | [tert-butyl(dimethyl)silyl] 4-methyl-1,3-thiazole-5-carboxylate |
| SMILES | Cc1ncsc1C(=O)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C11H19NO2SSi/c1-8-9(15-7-12-8)10(13)14-16(5,6)11(2,3)4/h7H,1-6H3 |
| InChIKey | RDBMWXILGMFKCE-UHFFFAOYSA-N |
| XLogP | 3.61 |
| TPSA | 39.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.43 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|