C9H10F3NO2S — CID 86781460
4,4,4-trifluorobutyl 4-methyl-1,3-thiazole-5-carboxylate (PubChem CID 86781460) has the molecular formula C9H10F3NO2S and a molecular weight of 253.24 g/mol. Its IUPAC name is 4,4,4-trifluorobutyl 4-methyl-1,3-thiazole-5-carboxylate.
| Compound Name | 4,4,4-trifluorobutyl 4-methyl-1,3-thiazole-5-carboxylate |
|---|---|
| PubChem CID | 86781460 |
| Molecular Formula | C9H10F3NO2S |
| Molecular Weight | 253.24 g/mol |
| Exact Mass | 253.04 |
| IUPAC Name | 4,4,4-trifluorobutyl 4-methyl-1,3-thiazole-5-carboxylate |
| SMILES | Cc1ncsc1C(=O)OCCCC(F)(F)F |
| InChI | InChI=1S/C9H10F3NO2S/c1-6-7(16-5-13-6)8(14)15-4-2-3-9(10,11)12/h5H,2-4H2,1H3 |
| InChIKey | LLLDUKLREFMBPE-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 39.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.24 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|