C12H17ClN4O2S2 — CID 161462361
ethyl 4-methyl-1,3-thiazole-5-carboxylate;4-methyl-1,3-thiazole-5-carboximidamide;hydrochloride (PubChem CID 161462361) has the molecular formula C12H17ClN4O2S2 and a molecular weight of 348.88 g/mol. Its IUPAC name is ethyl 4-methyl-1,3-thiazole-5-carboxylate;4-methyl-1,3-thiazole-5-carboximidamide;hydrochloride.
| Compound Name | ethyl 4-methyl-1,3-thiazole-5-carboxylate;4-methyl-1,3-thiazole-5-carboximidamide;hydrochloride |
|---|---|
| PubChem CID | 161462361 |
| Molecular Formula | C12H17ClN4O2S2 |
| Molecular Weight | 348.88 g/mol |
| Exact Mass | 348.05 |
| IUPAC Name | ethyl 4-methyl-1,3-thiazole-5-carboxylate;4-methyl-1,3-thiazole-5-carboximidamide;hydrochloride |
| SMILES | CCOC(=O)c1scnc1C.Cl.[H]/N=C(\N)c1scnc1C |
| InChI | InChI=1S/C7H9NO2S.C5H7N3S.ClH/c1-3-10-7(9)6-5(2)8-4-11-6;1-3-4(5(6)7)9-2-8-3;/h4H,3H2,1-2H3;2H,1H3,(H3,6,7);1H |
| InChIKey | JYTBSSKVOXCAOD-UHFFFAOYSA-N |
| XLogP | 2.79 |
| TPSA | 101.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.88 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|