C14H13BrN2O3S — CID 43623847
ethyl 3-bromo-4-[(4-methyl-1,3-thiazole-5-carbonyl)amino]benzoate (PubChem CID 43623847) has the molecular formula C14H13BrN2O3S and a molecular weight of 369.24 g/mol. Its IUPAC name is ethyl 3-bromo-4-[(4-methyl-1,3-thiazole-5-carbonyl)amino]benzoate.
| Compound Name | ethyl 3-bromo-4-[(4-methyl-1,3-thiazole-5-carbonyl)amino]benzoate |
|---|---|
| PubChem CID | 43623847 |
| Molecular Formula | C14H13BrN2O3S |
| Molecular Weight | 369.24 g/mol |
| Exact Mass | 367.98 |
| IUPAC Name | ethyl 3-bromo-4-[(4-methyl-1,3-thiazole-5-carbonyl)amino]benzoate |
| SMILES | CCOC(=O)c1ccc(NC(=O)c2scnc2C)c(Br)c1 |
| InChI | InChI=1S/C14H13BrN2O3S/c1-3-20-14(19)9-4-5-11(10(15)6-9)17-13(18)12-8(2)16-7-21-12/h4-7H,3H2,1-2H3,(H,17,18) |
| InChIKey | DKJRQICDXPREGF-UHFFFAOYSA-N |
| XLogP | 3.64 |
| TPSA | 68.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.24 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |